C38H40N4O5S2 — CID 19051565
methyl 2-[2-[3-[[(E)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19051565) has the molecular formula C38H40N4O5S2 and a molecular weight of 696.90 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(E)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19051565 |
| Molecular Formula | C38H40N4O5S2 |
| Molecular Weight | 696.90 g/mol |
| Exact Mass | 696.24 |
| IUPAC Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(N(C)C)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1sc2c(c1C(=O)OC)CCCC2 |
| InChI | InChI=1S/C38H40N4O5S2/c1-5-31(36(45)41-37-33(38(46)47-4)29-16-9-10-17-32(29)49-37)48-28-15-11-14-26(23-28)39-35(44)30(40-34(43)25-12-7-6-8-13-25)22-24-18-20-27(21-19-24)42(2)3/h6-8,11-15,18-23,31H,5,9-10,16-17H2,1-4H3,(H,39,44)(H,40,43)(H,41,45)/b30-22+ |
| InChIKey | JHTRYOYZFAIDHH-JBASAIQMSA-N |
| XLogP | 7.40 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.90 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|