C40H44N4O5S2 — CID 19051490
ethyl 2-[2-[3-[[(E)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19051490) has the molecular formula C40H44N4O5S2 and a molecular weight of 724.95 g/mol. Its IUPAC name is ethyl 2-[2-[3-[[(E)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-[[(E)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19051490 |
| Molecular Formula | C40H44N4O5S2 |
| Molecular Weight | 724.95 g/mol |
| Exact Mass | 724.28 |
| IUPAC Name | ethyl 2-[2-[3-[[(E)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C\c3ccc(N(C)C)cc3)NC(=O)c3ccccc3)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C40H44N4O5S2/c1-5-49-40(48)35-32-18-11-6-7-12-19-34(32)51-39(35)43-36(45)26(2)50-31-17-13-16-29(25-31)41-38(47)33(42-37(46)28-14-9-8-10-15-28)24-27-20-22-30(23-21-27)44(3)4/h8-10,13-17,20-26H,5-7,11-12,18-19H2,1-4H3,(H,41,47)(H,42,46)(H,43,45)/b33-24+ |
| InChIKey | YXJJRXRLGNXMIB-IWBSIUBASA-N |
| XLogP | 8.18 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.95 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|