C38H38BrN3O5S2 — CID 19054591
methyl 2-[2-[3-[[(E)-2-benzamido-3-(4-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19054591) has the molecular formula C38H38BrN3O5S2 and a molecular weight of 760.78 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(E)-2-benzamido-3-(4-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(4-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19054591 |
| Molecular Formula | C38H38BrN3O5S2 |
| Molecular Weight | 760.78 g/mol |
| Exact Mass | 759.14 |
| IUPAC Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(4-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(Br)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1sc2c(c1C(=O)OC)CCCCCC2 |
| InChI | InChI=1S/C38H38BrN3O5S2/c1-3-31(36(45)42-37-33(38(46)47-2)29-16-9-4-5-10-17-32(29)49-37)48-28-15-11-14-27(23-28)40-35(44)30(22-24-18-20-26(39)21-19-24)41-34(43)25-12-7-6-8-13-25/h6-8,11-15,18-23,31H,3-5,9-10,16-17H2,1-2H3,(H,40,44)(H,41,43)(H,42,45)/b30-22+ |
| InChIKey | VXOCAZVBPNPTDU-JBASAIQMSA-N |
| XLogP | 8.88 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.78 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|