C39H41N3O5S2 — CID 19053931
methyl 2-[2-[3-[[(E)-2-benzamido-3-(4-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19053931) has the molecular formula C39H41N3O5S2 and a molecular weight of 695.91 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(E)-2-benzamido-3-(4-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(4-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19053931 |
| Molecular Formula | C39H41N3O5S2 |
| Molecular Weight | 695.91 g/mol |
| Exact Mass | 695.25 |
| IUPAC Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(4-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(C)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1sc2c(c1C(=O)OC)CCCCCC2 |
| InChI | InChI=1S/C39H41N3O5S2/c1-4-32(37(45)42-38-34(39(46)47-3)30-17-10-5-6-11-18-33(30)49-38)48-29-16-12-15-28(24-29)40-36(44)31(23-26-21-19-25(2)20-22-26)41-35(43)27-13-8-7-9-14-27/h7-9,12-16,19-24,32H,4-6,10-11,17-18H2,1-3H3,(H,40,44)(H,41,43)(H,42,45)/b31-23+ |
| InChIKey | DSLFMXGTBLEKNZ-UQRQXUALSA-N |
| XLogP | 8.42 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.91 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|