C37H36N4O5S2 — CID 19051416
N-[(E)-3-[3-[1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19051416) has the molecular formula C37H36N4O5S2 and a molecular weight of 680.85 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19051416 |
| Molecular Formula | C37H36N4O5S2 |
| Molecular Weight | 680.85 g/mol |
| Exact Mass | 680.21 |
| IUPAC Name | N-[(E)-3-[3-[1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(OC)c(OC)c2)NC(=O)c2ccccc2)c1)C(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C37H36N4O5S2/c1-4-32(36(44)41-37-28(22-38)27-15-8-9-16-33(27)48-37)47-26-14-10-13-25(21-26)39-35(43)29(40-34(42)24-11-6-5-7-12-24)19-23-17-18-30(45-2)31(20-23)46-3/h5-7,10-14,17-21,32H,4,8-9,15-16H2,1-3H3,(H,39,43)(H,40,42)(H,41,44)/b29-19+ |
| InChIKey | KGELYDAODAOIBF-VUTHCHCSSA-N |
| XLogP | 7.43 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.85 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|