C38H38N4O5S2 — CID 19051021
N-[(E)-3-[3-[1-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19051021) has the molecular formula C38H38N4O5S2 and a molecular weight of 694.88 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19051021 |
| Molecular Formula | C38H38N4O5S2 |
| Molecular Weight | 694.88 g/mol |
| Exact Mass | 694.23 |
| IUPAC Name | N-[(E)-3-[3-[1-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cccc(OC)c2OC)NC(=O)c2ccccc2)c1)C(=O)Nc1sc2c(c1C#N)CCC(C)C2 |
| InChI | InChI=1S/C38H38N4O5S2/c1-5-32(37(45)42-38-29(22-39)28-18-17-23(2)19-33(28)49-38)48-27-15-10-14-26(21-27)40-36(44)30(41-35(43)24-11-7-6-8-12-24)20-25-13-9-16-31(46-3)34(25)47-4/h6-16,20-21,23,32H,5,17-19H2,1-4H3,(H,40,44)(H,41,43)(H,42,45)/b30-20+ |
| InChIKey | ATFAOHBXUWFFML-TWKHWXDSSA-N |
| XLogP | 7.68 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.88 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|