C37H35Cl2N3O5S2 — CID 19050767
methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19050767) has the molecular formula C37H35Cl2N3O5S2 and a molecular weight of 736.74 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19050767 |
| Molecular Formula | C37H35Cl2N3O5S2 |
| Molecular Weight | 736.74 g/mol |
| Exact Mass | 735.14 |
| IUPAC Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(Cl)cc2Cl)NC(=O)c2ccccc2)c1)C(=O)Nc1sc2c(c1C(=O)OC)CCC(C)C2 |
| InChI | InChI=1S/C37H35Cl2N3O5S2/c1-4-30(35(45)42-36-32(37(46)47-3)27-16-13-21(2)17-31(27)49-36)48-26-12-8-11-25(20-26)40-34(44)29(18-23-14-15-24(38)19-28(23)39)41-33(43)22-9-6-5-7-10-22/h5-12,14-15,18-21,30H,4,13,16-17H2,1-3H3,(H,40,44)(H,41,43)(H,42,45)/b29-18+ |
| InChIKey | UWPRKPFYCXOCDR-RDRPBHBLSA-N |
| XLogP | 8.89 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.74 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|