C42H38N4O7S2 — CID 19322447
ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 19322447) has the molecular formula C42H38N4O7S2 and a molecular weight of 774.92 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19322447 |
| Molecular Formula | C42H38N4O7S2 |
| Molecular Weight | 774.92 g/mol |
| Exact Mass | 774.22 |
| IUPAC Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(Sc2cccc(NC(=O)/C(=C\c3ccccc3[N+](=O)[O-])NC(=O)c3ccccc3)c2)c2ccccc2)sc2c1CCCCC2 |
| InChI | InChI=1S/C42H38N4O7S2/c1-2-53-42(50)36-32-22-10-5-11-24-35(32)55-41(36)45-40(49)37(27-15-6-3-7-16-27)54-31-21-14-20-30(26-31)43-39(48)33(44-38(47)28-17-8-4-9-18-28)25-29-19-12-13-23-34(29)46(51)52/h3-4,6-9,12-21,23,25-26,37H,2,5,10-11,22,24H2,1H3,(H,43,48)(H,44,47)(H,45,49)/b33-25+ |
| InChIKey | VRZCMQACKJNRGF-INKHBPHZSA-N |
| XLogP | 8.98 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.92 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|