C36H33Cl2N3O5S2 — CID 19322513
ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 19322513) has the molecular formula C36H33Cl2N3O5S2 and a molecular weight of 722.72 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19322513 |
| Molecular Formula | C36H33Cl2N3O5S2 |
| Molecular Weight | 722.72 g/mol |
| Exact Mass | 721.12 |
| IUPAC Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2cccc(NC(=O)/C(=C\c3cccc(Cl)c3Cl)NC(=O)c3ccccc3)c2)sc2c1CCCCC2 |
| InChI | InChI=1S/C36H33Cl2N3O5S2/c1-2-46-36(45)31-26-16-7-4-8-18-29(26)48-35(31)41-30(42)21-47-25-15-10-14-24(20-25)39-34(44)28(19-23-13-9-17-27(37)32(23)38)40-33(43)22-11-5-3-6-12-22/h3,5-6,9-15,17,19-20H,2,4,7-8,16,18,21H2,1H3,(H,39,44)(H,40,43)(H,41,42)/b28-19+ |
| InChIKey | QXAIDSHBULFIJG-TURZUDJPSA-N |
| XLogP | 8.64 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.72 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|