C35H35N3O5S3 — CID 19053503
ethyl 2-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19053503) has the molecular formula C35H35N3O5S3 and a molecular weight of 673.88 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19053503 |
| Molecular Formula | C35H35N3O5S3 |
| Molecular Weight | 673.88 g/mol |
| Exact Mass | 673.17 |
| IUPAC Name | ethyl 2-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2cccc(NC(=O)/C(=C/c3cccs3)NC(=O)c3ccccc3)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C35H35N3O5S3/c1-2-43-35(42)31-27-17-8-3-4-9-18-29(27)46-34(31)38-30(39)22-45-25-15-10-14-24(20-25)36-33(41)28(21-26-16-11-19-44-26)37-32(40)23-12-6-5-7-13-23/h5-7,10-16,19-21H,2-4,8-9,17-18,22H2,1H3,(H,36,41)(H,37,40)(H,38,39)/b28-21- |
| InChIKey | XNEHTYOJORBGCS-HFTWOUSFSA-N |
| XLogP | 7.79 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.88 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|