C28H31N3O3S3 — CID 19317444
ethyl 2-[[2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19317444) has the molecular formula C28H31N3O3S3 and a molecular weight of 553.78 g/mol. Its IUPAC name is ethyl 2-[[2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19317444 |
| Molecular Formula | C28H31N3O3S3 |
| Molecular Weight | 553.78 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | ethyl 2-[[2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2cccc(NC(=S)Nc3ccccc3)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C28H31N3O3S3/c1-2-34-27(33)25-22-15-8-3-4-9-16-23(22)37-26(25)31-24(32)18-36-21-14-10-13-20(17-21)30-28(35)29-19-11-6-5-7-12-19/h5-7,10-14,17H,2-4,8-9,15-16,18H2,1H3,(H,31,32)(H2,29,30,35) |
| InChIKey | KIYWJBWWUAYEAW-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.78 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|