C24H28N2O6S2 — CID 18898258
4-[3-[2-[(3-methoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxoethyl]sulfanylanilino]-4-oxobutanoic acid (PubChem CID 18898258) has the molecular formula C24H28N2O6S2 and a molecular weight of 504.63 g/mol. Its IUPAC name is 4-[3-[2-[(3-methoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxoethyl]sulfanylanilino]-4-oxobutanoic acid.
| Compound Name | 4-[3-[2-[(3-methoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxoethyl]sulfanylanilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18898258 |
| Molecular Formula | C24H28N2O6S2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 4-[3-[2-[(3-methoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxoethyl]sulfanylanilino]-4-oxobutanoic acid |
| SMILES | COC(=O)c1c(NC(=O)CSc2cccc(NC(=O)CCC(=O)O)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C24H28N2O6S2/c1-32-24(31)22-17-9-4-2-3-5-10-18(17)34-23(22)26-20(28)14-33-16-8-6-7-15(13-16)25-19(27)11-12-21(29)30/h6-8,13H,2-5,9-12,14H2,1H3,(H,25,27)(H,26,28)(H,29,30) |
| InChIKey | JYWNQQKRMAUTNY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |