C26H25N3O6S2 — CID 18910724
methyl 2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 18910724) has the molecular formula C26H25N3O6S2 and a molecular weight of 539.64 g/mol. Its IUPAC name is methyl 2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18910724 |
| Molecular Formula | C26H25N3O6S2 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | methyl 2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CSc2cccc(NC(=O)c3ccc([N+](=O)[O-])cc3)c2)sc2c1CCCCC2 |
| InChI | InChI=1S/C26H25N3O6S2/c1-35-26(32)23-20-8-3-2-4-9-21(20)37-25(23)28-22(30)15-36-19-7-5-6-17(14-19)27-24(31)16-10-12-18(13-11-16)29(33)34/h5-7,10-14H,2-4,8-9,15H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | XZTIRDNCLPIBPS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|