C29H24N4O7S2 — CID 18910749
methyl 4-methyl-2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5-(phenylcarbamoyl)thiophene-3-carboxylate (PubChem CID 18910749) has the molecular formula C29H24N4O7S2 and a molecular weight of 604.67 g/mol. Its IUPAC name is methyl 4-methyl-2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5-(phenylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | methyl 4-methyl-2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5-(phenylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18910749 |
| Molecular Formula | C29H24N4O7S2 |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.11 |
| IUPAC Name | methyl 4-methyl-2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylacetyl]amino]-5-(phenylcarbamoyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CSc2cccc(NC(=O)c3ccc([N+](=O)[O-])cc3)c2)sc(C(=O)Nc2ccccc2)c1C |
| InChI | InChI=1S/C29H24N4O7S2/c1-17-24(29(37)40-2)28(42-25(17)27(36)30-19-7-4-3-5-8-19)32-23(34)16-41-22-10-6-9-20(15-22)31-26(35)18-11-13-21(14-12-18)33(38)39/h3-15H,16H2,1-2H3,(H,30,36)(H,31,35)(H,32,34) |
| InChIKey | WJYXYZXIBQIJOJ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|