C21H15N5O10S — CID 17063875
methyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-[(3-nitrophenyl)carbamoyl]thiophene-3-carboxylate (PubChem CID 17063875) has the molecular formula C21H15N5O10S and a molecular weight of 529.44 g/mol. Its IUPAC name is methyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-[(3-nitrophenyl)carbamoyl]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-[(3-nitrophenyl)carbamoyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17063875 |
| Molecular Formula | C21H15N5O10S |
| Molecular Weight | 529.44 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | methyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-[(3-nitrophenyl)carbamoyl]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)sc(C(=O)Nc2cccc([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C21H15N5O10S/c1-10-16(21(29)36-2)20(23-18(27)11-6-14(25(32)33)9-15(7-11)26(34)35)37-17(10)19(28)22-12-4-3-5-13(8-12)24(30)31/h3-9H,1-2H3,(H,22,28)(H,23,27) |
| InChIKey | PDLSGDAYPTZGCA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 213.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|