C22H17ClN4O8S — CID 17064290
ethyl 2-[(4-chloro-3-nitrobenzoyl)amino]-4-methyl-5-[(3-nitrophenyl)carbamoyl]thiophene-3-carboxylate (PubChem CID 17064290) has the molecular formula C22H17ClN4O8S and a molecular weight of 532.92 g/mol. Its IUPAC name is ethyl 2-[(4-chloro-3-nitrobenzoyl)amino]-4-methyl-5-[(3-nitrophenyl)carbamoyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(4-chloro-3-nitrobenzoyl)amino]-4-methyl-5-[(3-nitrophenyl)carbamoyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17064290 |
| Molecular Formula | C22H17ClN4O8S |
| Molecular Weight | 532.92 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | ethyl 2-[(4-chloro-3-nitrobenzoyl)amino]-4-methyl-5-[(3-nitrophenyl)carbamoyl]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)sc(C(=O)Nc2cccc([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C22H17ClN4O8S/c1-3-35-22(30)17-11(2)18(20(29)24-13-5-4-6-14(10-13)26(31)32)36-21(17)25-19(28)12-7-8-15(23)16(9-12)27(33)34/h4-10H,3H2,1-2H3,(H,24,29)(H,25,28) |
| InChIKey | ASLXZCNANPKIBI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.92 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|