C18H20N4O6S — CID 26506129
ethyl 4-methyl-5-(methylcarbamoyl)-2-[[2-(3-nitroanilino)acetyl]amino]thiophene-3-carboxylate (PubChem CID 26506129) has the molecular formula C18H20N4O6S and a molecular weight of 420.45 g/mol. Its IUPAC name is ethyl 4-methyl-5-(methylcarbamoyl)-2-[[2-(3-nitroanilino)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-methyl-5-(methylcarbamoyl)-2-[[2-(3-nitroanilino)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 26506129 |
| Molecular Formula | C18H20N4O6S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | ethyl 4-methyl-5-(methylcarbamoyl)-2-[[2-(3-nitroanilino)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CNc2cccc([N+](=O)[O-])c2)sc(C(=O)NC)c1C |
| InChI | InChI=1S/C18H20N4O6S/c1-4-28-18(25)14-10(2)15(16(24)19-3)29-17(14)21-13(23)9-20-11-6-5-7-12(8-11)22(26)27/h5-8,20H,4,9H2,1-3H3,(H,19,24)(H,21,23) |
| InChIKey | WTOUZBRQDZDNEQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|