C22H18ClN3O6S — CID 17063090
ethyl 5-[(4-chlorophenyl)carbamoyl]-4-methyl-2-[(3-nitrobenzoyl)amino]thiophene-3-carboxylate (PubChem CID 17063090) has the molecular formula C22H18ClN3O6S and a molecular weight of 487.92 g/mol. Its IUPAC name is ethyl 5-[(4-chlorophenyl)carbamoyl]-4-methyl-2-[(3-nitrobenzoyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-[(4-chlorophenyl)carbamoyl]-4-methyl-2-[(3-nitrobenzoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17063090 |
| Molecular Formula | C22H18ClN3O6S |
| Molecular Weight | 487.92 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | ethyl 5-[(4-chlorophenyl)carbamoyl]-4-methyl-2-[(3-nitrobenzoyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cccc([N+](=O)[O-])c2)sc(C(=O)Nc2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C22H18ClN3O6S/c1-3-32-22(29)17-12(2)18(20(28)24-15-9-7-14(23)8-10-15)33-21(17)25-19(27)13-5-4-6-16(11-13)26(30)31/h4-11H,3H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | FFMWSTWMARKRDR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.92 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|