C23H20ClN3O7S — CID 17065107
ethyl 2-[(4-chloro-3-nitrobenzoyl)amino]-5-[(3-methoxyphenyl)carbamoyl]-4-methylthiophene-3-carboxylate (PubChem CID 17065107) has the molecular formula C23H20ClN3O7S and a molecular weight of 517.95 g/mol. Its IUPAC name is ethyl 2-[(4-chloro-3-nitrobenzoyl)amino]-5-[(3-methoxyphenyl)carbamoyl]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(4-chloro-3-nitrobenzoyl)amino]-5-[(3-methoxyphenyl)carbamoyl]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17065107 |
| Molecular Formula | C23H20ClN3O7S |
| Molecular Weight | 517.95 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | ethyl 2-[(4-chloro-3-nitrobenzoyl)amino]-5-[(3-methoxyphenyl)carbamoyl]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)sc(C(=O)Nc2cccc(OC)c2)c1C |
| InChI | InChI=1S/C23H20ClN3O7S/c1-4-34-23(30)18-12(2)19(21(29)25-14-6-5-7-15(11-14)33-3)35-22(18)26-20(28)13-8-9-16(24)17(10-13)27(31)32/h5-11H,4H2,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | CQRFZYBNNSRMOV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.95 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|