C17H16N2O7S — CID 23822165
4-O-ethyl 2-O-methyl 3-methyl-5-[(3-nitrobenzoyl)amino]thiophene-2,4-dicarboxylate (PubChem CID 23822165) has the molecular formula C17H16N2O7S and a molecular weight of 392.39 g/mol. Its IUPAC name is 4-O-ethyl 2-O-methyl 3-methyl-5-[(3-nitrobenzoyl)amino]thiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-methyl 3-methyl-5-[(3-nitrobenzoyl)amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 23822165 |
| Molecular Formula | C17H16N2O7S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 4-O-ethyl 2-O-methyl 3-methyl-5-[(3-nitrobenzoyl)amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cccc([N+](=O)[O-])c2)sc(C(=O)OC)c1C |
| InChI | InChI=1S/C17H16N2O7S/c1-4-26-16(21)12-9(2)13(17(22)25-3)27-15(12)18-14(20)10-6-5-7-11(8-10)19(23)24/h5-8H,4H2,1-3H3,(H,18,20) |
| InChIKey | FTWNOANRSBBUEC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|