C20H20N4O8S — CID 17061995
ethyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-(pyrrolidine-1-carbonyl)thiophene-3-carboxylate (PubChem CID 17061995) has the molecular formula C20H20N4O8S and a molecular weight of 476.47 g/mol. Its IUPAC name is ethyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-(pyrrolidine-1-carbonyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-(pyrrolidine-1-carbonyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17061995 |
| Molecular Formula | C20H20N4O8S |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | ethyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-(pyrrolidine-1-carbonyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)sc(C(=O)N2CCCC2)c1C |
| InChI | InChI=1S/C20H20N4O8S/c1-3-32-20(27)15-11(2)16(19(26)22-6-4-5-7-22)33-18(15)21-17(25)12-8-13(23(28)29)10-14(9-12)24(30)31/h8-10H,3-7H2,1-2H3,(H,21,25) |
| InChIKey | XCFOYICCRYCYIM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|