C19H18N4O9S — CID 17061139
methyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-(morpholine-4-carbonyl)thiophene-3-carboxylate (PubChem CID 17061139) has the molecular formula C19H18N4O9S and a molecular weight of 478.44 g/mol. Its IUPAC name is methyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-(morpholine-4-carbonyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-(morpholine-4-carbonyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17061139 |
| Molecular Formula | C19H18N4O9S |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | methyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-(morpholine-4-carbonyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)sc(C(=O)N2CCOCC2)c1C |
| InChI | InChI=1S/C19H18N4O9S/c1-10-14(19(26)31-2)17(33-15(10)18(25)21-3-5-32-6-4-21)20-16(24)11-7-12(22(27)28)9-13(8-11)23(29)30/h7-9H,3-6H2,1-2H3,(H,20,24) |
| InChIKey | OGYANUILOANVQM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|