C23H20N4O8S — CID 17062524
methyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-(1-phenylethylcarbamoyl)thiophene-3-carboxylate (PubChem CID 17062524) has the molecular formula C23H20N4O8S and a molecular weight of 512.50 g/mol. Its IUPAC name is methyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-(1-phenylethylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-(1-phenylethylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17062524 |
| Molecular Formula | C23H20N4O8S |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | methyl 2-[(3,5-dinitrobenzoyl)amino]-4-methyl-5-(1-phenylethylcarbamoyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)sc(C(=O)NC(C)c2ccccc2)c1C |
| InChI | InChI=1S/C23H20N4O8S/c1-12-18(23(30)35-3)22(36-19(12)21(29)24-13(2)14-7-5-4-6-8-14)25-20(28)15-9-16(26(31)32)11-17(10-15)27(33)34/h4-11,13H,1-3H3,(H,24,29)(H,25,28) |
| InChIKey | SDFJCPIFTXCYJC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|