C22H19N3O6S — CID 17062815
methyl 5-(benzylcarbamoyl)-4-methyl-2-[(4-nitrobenzoyl)amino]thiophene-3-carboxylate (PubChem CID 17062815) has the molecular formula C22H19N3O6S and a molecular weight of 453.48 g/mol. Its IUPAC name is methyl 5-(benzylcarbamoyl)-4-methyl-2-[(4-nitrobenzoyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-(benzylcarbamoyl)-4-methyl-2-[(4-nitrobenzoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17062815 |
| Molecular Formula | C22H19N3O6S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | methyl 5-(benzylcarbamoyl)-4-methyl-2-[(4-nitrobenzoyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2ccc([N+](=O)[O-])cc2)sc(C(=O)NCc2ccccc2)c1C |
| InChI | InChI=1S/C22H19N3O6S/c1-13-17(22(28)31-2)21(24-19(26)15-8-10-16(11-9-15)25(29)30)32-18(13)20(27)23-12-14-6-4-3-5-7-14/h3-11H,12H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | PJHYZYGVGYEKRM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|