C25H23N3O8S — CID 2860504
ethyl 5-[(4-ethoxycarbonylphenyl)carbamoyl]-4-methyl-2-[(4-nitrobenzoyl)amino]thiophene-3-carboxylate (PubChem CID 2860504) has the molecular formula C25H23N3O8S and a molecular weight of 525.54 g/mol. Its IUPAC name is ethyl 5-[(4-ethoxycarbonylphenyl)carbamoyl]-4-methyl-2-[(4-nitrobenzoyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-[(4-ethoxycarbonylphenyl)carbamoyl]-4-methyl-2-[(4-nitrobenzoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2860504 |
| Molecular Formula | C25H23N3O8S |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | ethyl 5-[(4-ethoxycarbonylphenyl)carbamoyl]-4-methyl-2-[(4-nitrobenzoyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2sc(NC(=O)c3ccc([N+](=O)[O-])cc3)c(C(=O)OCC)c2C)cc1 |
| InChI | InChI=1S/C25H23N3O8S/c1-4-35-24(31)16-6-10-17(11-7-16)26-22(30)20-14(3)19(25(32)36-5-2)23(37-20)27-21(29)15-8-12-18(13-9-15)28(33)34/h6-13H,4-5H2,1-3H3,(H,26,30)(H,27,29) |
| InChIKey | KMBKQBQVFRCXAA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|