C16H14N4O8S — CID 3587276
ethyl 5-carbamoyl-2-[(2,4-dinitrobenzoyl)amino]-4-methylthiophene-3-carboxylate (PubChem CID 3587276) has the molecular formula C16H14N4O8S and a molecular weight of 422.38 g/mol. Its IUPAC name is ethyl 5-carbamoyl-2-[(2,4-dinitrobenzoyl)amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-carbamoyl-2-[(2,4-dinitrobenzoyl)amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3587276 |
| Molecular Formula | C16H14N4O8S |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | ethyl 5-carbamoyl-2-[(2,4-dinitrobenzoyl)amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])sc(C(N)=O)c1C |
| InChI | InChI=1S/C16H14N4O8S/c1-3-28-16(23)11-7(2)12(13(17)21)29-15(11)18-14(22)9-5-4-8(19(24)25)6-10(9)20(26)27/h4-6H,3H2,1-2H3,(H2,17,21)(H,18,22) |
| InChIKey | NZCKOSPRNPOACY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 184.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|