C19H19N3O9S — CID 47085000
ethyl 2-[[2-(2-hydroxy-5-nitrobenzoyl)oxyacetyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate (PubChem CID 47085000) has the molecular formula C19H19N3O9S and a molecular weight of 465.44 g/mol. Its IUPAC name is ethyl 2-[[2-(2-hydroxy-5-nitrobenzoyl)oxyacetyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(2-hydroxy-5-nitrobenzoyl)oxyacetyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 47085000 |
| Molecular Formula | C19H19N3O9S |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | ethyl 2-[[2-(2-hydroxy-5-nitrobenzoyl)oxyacetyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)c2cc([N+](=O)[O-])ccc2O)sc(C(=O)NC)c1C |
| InChI | InChI=1S/C19H19N3O9S/c1-4-30-19(27)14-9(2)15(16(25)20-3)32-17(14)21-13(24)8-31-18(26)11-7-10(22(28)29)5-6-12(11)23/h5-7,23H,4,8H2,1-3H3,(H,20,25)(H,21,24) |
| InChIKey | XOGWKYAFCXXTCI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 174.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|