C17H17N3O9S — CID 2637592
[2-[[3-ethoxycarbonyl-4-methyl-5-(methylcarbamoyl)thiophen-2-yl]amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate (PubChem CID 2637592) has the molecular formula C17H17N3O9S and a molecular weight of 439.40 g/mol. Its IUPAC name is [2-[[3-ethoxycarbonyl-4-methyl-5-(methylcarbamoyl)thiophen-2-yl]amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-[[3-ethoxycarbonyl-4-methyl-5-(methylcarbamoyl)thiophen-2-yl]amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 2637592 |
| Molecular Formula | C17H17N3O9S |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | [2-[[3-ethoxycarbonyl-4-methyl-5-(methylcarbamoyl)thiophen-2-yl]amino]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)c2ccc([N+](=O)[O-])o2)sc(C(=O)NC)c1C |
| InChI | InChI=1S/C17H17N3O9S/c1-4-27-17(24)12-8(2)13(14(22)18-3)30-15(12)19-10(21)7-28-16(23)9-5-6-11(29-9)20(25)26/h5-6H,4,7H2,1-3H3,(H,18,22)(H,19,21) |
| InChIKey | NBDBHZQAZODUOY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 167.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|