C16H16N2O8S — CID 2294796
diethyl 3-methyl-5-[(5-nitrofuran-2-carbonyl)amino]thiophene-2,4-dicarboxylate (PubChem CID 2294796) has the molecular formula C16H16N2O8S and a molecular weight of 396.38 g/mol. Its IUPAC name is diethyl 3-methyl-5-[(5-nitrofuran-2-carbonyl)amino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[(5-nitrofuran-2-carbonyl)amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2294796 |
| Molecular Formula | C16H16N2O8S |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | diethyl 3-methyl-5-[(5-nitrofuran-2-carbonyl)amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2ccc([N+](=O)[O-])o2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C16H16N2O8S/c1-4-24-15(20)11-8(3)12(16(21)25-5-2)27-14(11)17-13(19)9-6-7-10(26-9)18(22)23/h6-7H,4-5H2,1-3H3,(H,17,19) |
| InChIKey | VDCLHJYXXIBLKD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|