C18H22N3O6S+ — CID 7095654
ethyl 2-[(5-nitrofuran-2-carbonyl)amino]-6-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate (PubChem CID 7095654) has the molecular formula C18H22N3O6S+ and a molecular weight of 408.46 g/mol. Its IUPAC name is ethyl 2-[(5-nitrofuran-2-carbonyl)amino]-6-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate.
| Compound Name | ethyl 2-[(5-nitrofuran-2-carbonyl)amino]-6-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
|---|---|
| PubChem CID | 7095654 |
| Molecular Formula | C18H22N3O6S+ |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | ethyl 2-[(5-nitrofuran-2-carbonyl)amino]-6-propan-2-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc([N+](=O)[O-])o2)sc2c1CC[NH+](C(C)C)C2 |
| InChI | InChI=1S/C18H21N3O6S/c1-4-26-18(23)15-11-7-8-20(10(2)3)9-13(11)28-17(15)19-16(22)12-5-6-14(27-12)21(24)25/h5-6,10H,4,7-9H2,1-3H3,(H,19,22)/p+1 |
| InChIKey | WQBBZZYWRYZIOG-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 116.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|