C16H17N3O5S — CID 7475072
N-[3-(methylcarbamoyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]-5-nitrofuran-2-carboxamide (PubChem CID 7475072) has the molecular formula C16H17N3O5S and a molecular weight of 363.40 g/mol. Its IUPAC name is N-[3-(methylcarbamoyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[3-(methylcarbamoyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 7475072 |
| Molecular Formula | C16H17N3O5S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-[3-(methylcarbamoyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]-5-nitrofuran-2-carboxamide |
| SMILES | CNC(=O)c1c(NC(=O)c2ccc([N+](=O)[O-])o2)sc2c1CCCCC2 |
| InChI | InChI=1S/C16H17N3O5S/c1-17-15(21)13-9-5-3-2-4-6-11(9)25-16(13)18-14(20)10-7-8-12(24-10)19(22)23/h7-8H,2-6H2,1H3,(H,17,21)(H,18,20) |
| InChIKey | SDQJGKSVQOPONZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|