C20H20N4O8S — CID 19459130
diethyl 3-methyl-5-[[5-[(4-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 19459130) has the molecular formula C20H20N4O8S and a molecular weight of 476.47 g/mol. Its IUPAC name is diethyl 3-methyl-5-[[5-[(4-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[[5-[(4-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19459130 |
| Molecular Formula | C20H20N4O8S |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | diethyl 3-methyl-5-[[5-[(4-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2ccc(Cn3cc([N+](=O)[O-])cn3)o2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C20H20N4O8S/c1-4-30-19(26)15-11(3)16(20(27)31-5-2)33-18(15)22-17(25)14-7-6-13(32-14)10-23-9-12(8-21-23)24(28)29/h6-9H,4-5,10H2,1-3H3,(H,22,25) |
| InChIKey | RGSVVHQCHIQCQU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 155.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|