C22H19ClN2O8S — CID 19459477
ethyl 5-acetyl-2-[[5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4-methylthiophene-3-carboxylate (PubChem CID 19459477) has the molecular formula C22H19ClN2O8S and a molecular weight of 506.92 g/mol. Its IUPAC name is ethyl 5-acetyl-2-[[5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-2-[[5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19459477 |
| Molecular Formula | C22H19ClN2O8S |
| Molecular Weight | 506.92 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | ethyl 5-acetyl-2-[[5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(COc3cc([N+](=O)[O-])ccc3Cl)o2)sc(C(C)=O)c1C |
| InChI | InChI=1S/C22H19ClN2O8S/c1-4-31-22(28)18-11(2)19(12(3)26)34-21(18)24-20(27)16-8-6-14(33-16)10-32-17-9-13(25(29)30)5-7-15(17)23/h5-9H,4,10H2,1-3H3,(H,24,27) |
| InChIKey | UAASPYOQGUPOOS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.92 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|