C19H14ClFN2O5 — CID 19459513
5-[(2-chloro-5-nitrophenoxy)methyl]-N-(2-fluoro-5-methylphenyl)furan-2-carboxamide (PubChem CID 19459513) has the molecular formula C19H14ClFN2O5 and a molecular weight of 404.78 g/mol. Its IUPAC name is 5-[(2-chloro-5-nitrophenoxy)methyl]-N-(2-fluoro-5-methylphenyl)furan-2-carboxamide.
| Compound Name | 5-[(2-chloro-5-nitrophenoxy)methyl]-N-(2-fluoro-5-methylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19459513 |
| Molecular Formula | C19H14ClFN2O5 |
| Molecular Weight | 404.78 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 5-[(2-chloro-5-nitrophenoxy)methyl]-N-(2-fluoro-5-methylphenyl)furan-2-carboxamide |
| SMILES | Cc1ccc(F)c(NC(=O)c2ccc(COc3cc([N+](=O)[O-])ccc3Cl)o2)c1 |
| InChI | InChI=1S/C19H14ClFN2O5/c1-11-2-6-15(21)16(8-11)22-19(24)17-7-4-13(28-17)10-27-18-9-12(23(25)26)3-5-14(18)20/h2-9H,10H2,1H3,(H,22,24) |
| InChIKey | HFSZNRYYAFNQQM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.78 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|