C19H12ClF3N2O6 — CID 19459716
5-[(2-chloro-5-nitrophenoxy)methyl]-N-[2-(difluoromethoxy)-4-fluorophenyl]furan-2-carboxamide (PubChem CID 19459716) has the molecular formula C19H12ClF3N2O6 and a molecular weight of 456.76 g/mol. Its IUPAC name is 5-[(2-chloro-5-nitrophenoxy)methyl]-N-[2-(difluoromethoxy)-4-fluorophenyl]furan-2-carboxamide.
| Compound Name | 5-[(2-chloro-5-nitrophenoxy)methyl]-N-[2-(difluoromethoxy)-4-fluorophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19459716 |
| Molecular Formula | C19H12ClF3N2O6 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 5-[(2-chloro-5-nitrophenoxy)methyl]-N-[2-(difluoromethoxy)-4-fluorophenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1OC(F)F)c1ccc(COc2cc([N+](=O)[O-])ccc2Cl)o1 |
| InChI | InChI=1S/C19H12ClF3N2O6/c20-13-4-2-11(25(27)28)8-16(13)29-9-12-3-6-15(30-12)18(26)24-14-5-1-10(21)7-17(14)31-19(22)23/h1-8,19H,9H2,(H,24,26) |
| InChIKey | YAHIYHQMLPGKQS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|