C18H12ClN3O7 — CID 19461760
5-[(2-chloro-4-nitrophenoxy)methyl]-N-(4-nitrophenyl)furan-2-carboxamide (PubChem CID 19461760) has the molecular formula C18H12ClN3O7 and a molecular weight of 417.76 g/mol. Its IUPAC name is 5-[(2-chloro-4-nitrophenoxy)methyl]-N-(4-nitrophenyl)furan-2-carboxamide.
| Compound Name | 5-[(2-chloro-4-nitrophenoxy)methyl]-N-(4-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19461760 |
| Molecular Formula | C18H12ClN3O7 |
| Molecular Weight | 417.76 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 5-[(2-chloro-4-nitrophenoxy)methyl]-N-(4-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)c1ccc(COc2ccc([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C18H12ClN3O7/c19-15-9-13(22(26)27)5-7-16(15)28-10-14-6-8-17(29-14)18(23)20-11-1-3-12(4-2-11)21(24)25/h1-9H,10H2,(H,20,23) |
| InChIKey | CPNKKWBNEXQHLV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.76 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|