C17H12ClN5O5 — CID 19463617
5-[(2-chloro-4-nitrophenoxy)methyl]-N-(4-cyano-1-methylpyrazol-5-yl)furan-2-carboxamide (PubChem CID 19463617) has the molecular formula C17H12ClN5O5 and a molecular weight of 401.77 g/mol. Its IUPAC name is 5-[(2-chloro-4-nitrophenoxy)methyl]-N-(4-cyano-1-methylpyrazol-5-yl)furan-2-carboxamide.
| Compound Name | 5-[(2-chloro-4-nitrophenoxy)methyl]-N-(4-cyano-1-methylpyrazol-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19463617 |
| Molecular Formula | C17H12ClN5O5 |
| Molecular Weight | 401.77 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 5-[(2-chloro-4-nitrophenoxy)methyl]-N-(4-cyano-1-methylpyrazol-5-yl)furan-2-carboxamide |
| SMILES | Cn1ncc(C#N)c1NC(=O)c1ccc(COc2ccc([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C17H12ClN5O5/c1-22-16(10(7-19)8-20-22)21-17(24)15-5-3-12(28-15)9-27-14-4-2-11(23(25)26)6-13(14)18/h2-6,8H,9H2,1H3,(H,21,24) |
| InChIKey | PKPGGTGJRKZOCC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 136.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.77 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|