C18H16ClN5O6 — CID 19463521
4-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-ethylpyrazole-3-carboxamide (PubChem CID 19463521) has the molecular formula C18H16ClN5O6 and a molecular weight of 433.81 g/mol. Its IUPAC name is 4-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19463521 |
| Molecular Formula | C18H16ClN5O6 |
| Molecular Weight | 433.81 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 4-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2ccc(COc3ccc([N+](=O)[O-])cc3Cl)o2)c(C(N)=O)n1 |
| InChI | InChI=1S/C18H16ClN5O6/c1-2-23-8-13(16(22-23)17(20)25)21-18(26)15-6-4-11(30-15)9-29-14-5-3-10(24(27)28)7-12(14)19/h3-8H,2,9H2,1H3,(H2,20,25)(H,21,26) |
| InChIKey | QFLJBFBLVVUUAG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.81 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|