C23H22ClN7O6 — CID 19463637
4-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-N-(1,5-dimethylpyrazol-4-yl)-1-ethylpyrazole-5-carboxamide (PubChem CID 19463637) has the molecular formula C23H22ClN7O6 and a molecular weight of 527.93 g/mol. Its IUPAC name is 4-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-N-(1,5-dimethylpyrazol-4-yl)-1-ethylpyrazole-5-carboxamide.
| Compound Name | 4-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-N-(1,5-dimethylpyrazol-4-yl)-1-ethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19463637 |
| Molecular Formula | C23H22ClN7O6 |
| Molecular Weight | 527.93 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 4-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-N-(1,5-dimethylpyrazol-4-yl)-1-ethylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(NC(=O)c2ccc(COc3ccc([N+](=O)[O-])cc3Cl)o2)c1C(=O)Nc1cnn(C)c1C |
| InChI | InChI=1S/C23H22ClN7O6/c1-4-30-21(23(33)27-17-10-25-29(3)13(17)2)18(11-26-30)28-22(32)20-8-6-15(37-20)12-36-19-7-5-14(31(34)35)9-16(19)24/h5-11H,4,12H2,1-3H3,(H,27,33)(H,28,32) |
| InChIKey | PCKQIAQAINONAE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.93 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|