C19H18ClN5O6 — CID 19463615
4-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-ethyl-N-methylpyrazole-3-carboxamide (PubChem CID 19463615) has the molecular formula C19H18ClN5O6 and a molecular weight of 447.84 g/mol. Its IUPAC name is 4-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-ethyl-N-methylpyrazole-3-carboxamide.
| Compound Name | 4-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-ethyl-N-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19463615 |
| Molecular Formula | C19H18ClN5O6 |
| Molecular Weight | 447.84 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 4-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-ethyl-N-methylpyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2ccc(COc3ccc([N+](=O)[O-])cc3Cl)o2)c(C(=O)NC)n1 |
| InChI | InChI=1S/C19H18ClN5O6/c1-3-24-9-14(17(23-24)19(27)21-2)22-18(26)16-7-5-12(31-16)10-30-15-6-4-11(25(28)29)8-13(15)20/h4-9H,3,10H2,1-2H3,(H,21,27)(H,22,26) |
| InChIKey | ICTZLSJEUVPCNM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 141.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.84 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|