C18H17ClN4O4 — CID 19412473
4-[[5-[(3-chlorophenoxy)methyl]furan-2-carbonyl]amino]-1-ethylpyrazole-3-carboxamide (PubChem CID 19412473) has the molecular formula C18H17ClN4O4 and a molecular weight of 388.81 g/mol. Its IUPAC name is 4-[[5-[(3-chlorophenoxy)methyl]furan-2-carbonyl]amino]-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-[[5-[(3-chlorophenoxy)methyl]furan-2-carbonyl]amino]-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19412473 |
| Molecular Formula | C18H17ClN4O4 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 4-[[5-[(3-chlorophenoxy)methyl]furan-2-carbonyl]amino]-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2ccc(COc3cccc(Cl)c3)o2)c(C(N)=O)n1 |
| InChI | InChI=1S/C18H17ClN4O4/c1-2-23-9-14(16(22-23)17(20)24)21-18(25)15-7-6-13(27-15)10-26-12-5-3-4-11(19)8-12/h3-9H,2,10H2,1H3,(H2,20,24)(H,21,25) |
| InChIKey | MMGGSSOWRGKWPE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |