C23H20ClN5O7 — CID 19459642
4-[[5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide (PubChem CID 19459642) has the molecular formula C23H20ClN5O7 and a molecular weight of 513.89 g/mol. Its IUPAC name is 4-[[5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 4-[[5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19459642 |
| Molecular Formula | C23H20ClN5O7 |
| Molecular Weight | 513.89 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 4-[[5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2ccc(COc3cc([N+](=O)[O-])ccc3Cl)o2)c(C(=O)NCc2ccco2)n1 |
| InChI | InChI=1S/C23H20ClN5O7/c1-2-28-12-18(21(27-28)23(31)25-11-15-4-3-9-34-15)26-22(30)19-8-6-16(36-19)13-35-20-10-14(29(32)33)5-7-17(20)24/h3-10,12H,2,11,13H2,1H3,(H,25,31)(H,26,30) |
| InChIKey | LNGPGVDNNOWUFA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 154.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|