C16H17N7O5 — CID 19264021
1-ethyl-N-(furan-2-ylmethyl)-4-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]pyrazole-3-carboxamide (PubChem CID 19264021) has the molecular formula C16H17N7O5 and a molecular weight of 387.36 g/mol. Its IUPAC name is 1-ethyl-N-(furan-2-ylmethyl)-4-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-N-(furan-2-ylmethyl)-4-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19264021 |
| Molecular Formula | C16H17N7O5 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-ethyl-N-(furan-2-ylmethyl)-4-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2nn(C)cc2[N+](=O)[O-])c(C(=O)NCc2ccco2)n1 |
| InChI | InChI=1S/C16H17N7O5/c1-3-22-8-11(13(20-22)15(24)17-7-10-5-4-6-28-10)18-16(25)14-12(23(26)27)9-21(2)19-14/h4-6,8-9H,3,7H2,1-2H3,(H,17,24)(H,18,25) |
| InChIKey | XMXPIUILAIBVGR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 150.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|