C18H21N7O5 — CID 19541900
1-ethyl-N-(furan-2-ylmethyl)-4-[3-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]pyrazole-3-carboxamide (PubChem CID 19541900) has the molecular formula C18H21N7O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is 1-ethyl-N-(furan-2-ylmethyl)-4-[3-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-N-(furan-2-ylmethyl)-4-[3-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19541900 |
| Molecular Formula | C18H21N7O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-ethyl-N-(furan-2-ylmethyl)-4-[3-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)CCn2nc([N+](=O)[O-])cc2C)c(C(=O)NCc2ccco2)n1 |
| InChI | InChI=1S/C18H21N7O5/c1-3-23-11-14(17(22-23)18(27)19-10-13-5-4-8-30-13)20-16(26)6-7-24-12(2)9-15(21-24)25(28)29/h4-5,8-9,11H,3,6-7,10H2,1-2H3,(H,19,27)(H,20,26) |
| InChIKey | XATHLMDIRFFQSV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 150.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|