C18H21N7O6 — CID 19558202
1-ethyl-N-(furan-2-ylmethyl)-4-[3-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]pyrazole-3-carboxamide (PubChem CID 19558202) has the molecular formula C18H21N7O6 and a molecular weight of 431.41 g/mol. Its IUPAC name is 1-ethyl-N-(furan-2-ylmethyl)-4-[3-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-N-(furan-2-ylmethyl)-4-[3-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19558202 |
| Molecular Formula | C18H21N7O6 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-ethyl-N-(furan-2-ylmethyl)-4-[3-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)CCn2cc([N+](=O)[O-])c(OC)n2)c(C(=O)NCc2ccco2)n1 |
| InChI | InChI=1S/C18H21N7O6/c1-3-23-10-13(16(21-23)17(27)19-9-12-5-4-8-31-12)20-15(26)6-7-24-11-14(25(28)29)18(22-24)30-2/h4-5,8,10-11H,3,6-7,9H2,1-2H3,(H,19,27)(H,20,26) |
| InChIKey | OVFWADFBVUJRKG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|