C17H18BrN7O5 — CID 19567901
4-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide (PubChem CID 19567901) has the molecular formula C17H18BrN7O5 and a molecular weight of 480.28 g/mol. Its IUPAC name is 4-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 4-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19567901 |
| Molecular Formula | C17H18BrN7O5 |
| Molecular Weight | 480.28 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 4-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)CCn2cc(Br)c([N+](=O)[O-])n2)c(C(=O)NCc2ccco2)n1 |
| InChI | InChI=1S/C17H18BrN7O5/c1-2-23-10-13(15(21-23)17(27)19-8-11-4-3-7-30-11)20-14(26)5-6-24-9-12(18)16(22-24)25(28)29/h3-4,7,9-10H,2,5-6,8H2,1H3,(H,19,27)(H,20,26) |
| InChIKey | BAFSDLNYALZQDY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 150.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|