C26H30BrN7O5 — CID 19400272
4-[[2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide (PubChem CID 19400272) has the molecular formula C26H30BrN7O5 and a molecular weight of 600.47 g/mol. Its IUPAC name is 4-[[2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 4-[[2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19400272 |
| Molecular Formula | C26H30BrN7O5 |
| Molecular Weight | 600.47 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | 4-[[2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]-1-ethyl-N-(furan-2-ylmethyl)pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)CC23CC4CC(C2)CC(n2cc(Br)c([N+](=O)[O-])n2)(C4)C3)c(C(=O)NCc2ccco2)n1 |
| InChI | InChI=1S/C26H30BrN7O5/c1-2-32-14-20(22(30-32)24(36)28-12-18-4-3-5-39-18)29-21(35)11-25-7-16-6-17(8-25)10-26(9-16,15-25)33-13-19(27)23(31-33)34(37)38/h3-5,13-14,16-17H,2,6-12,15H2,1H3,(H,28,36)(H,29,35) |
| InChIKey | HJMHWTBCZWPIHM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 150.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|