C27H30BrN7O4 — CID 19404705
4-[[2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]-1-ethyl-N-phenylpyrazole-3-carboxamide (PubChem CID 19404705) has the molecular formula C27H30BrN7O4 and a molecular weight of 596.49 g/mol. Its IUPAC name is 4-[[2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]-1-ethyl-N-phenylpyrazole-3-carboxamide.
| Compound Name | 4-[[2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]-1-ethyl-N-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19404705 |
| Molecular Formula | C27H30BrN7O4 |
| Molecular Weight | 596.49 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | 4-[[2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]-1-ethyl-N-phenylpyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)CC23CC4CC(C2)CC(n2cc(Br)c([N+](=O)[O-])n2)(C4)C3)c(C(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C27H30BrN7O4/c1-2-33-15-21(23(31-33)25(37)29-19-6-4-3-5-7-19)30-22(36)13-26-9-17-8-18(10-26)12-27(11-17,16-26)34-14-20(28)24(32-34)35(38)39/h3-7,14-15,17-18H,2,8-13,16H2,1H3,(H,29,37)(H,30,36) |
| InChIKey | SIYSMUNCDUMAMY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|