C24H33N7O4 — CID 19398443
1-ethyl-4-[[2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]-N-propylpyrazole-3-carboxamide (PubChem CID 19398443) has the molecular formula C24H33N7O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is 1-ethyl-4-[[2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]-N-propylpyrazole-3-carboxamide.
| Compound Name | 1-ethyl-4-[[2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]-N-propylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19398443 |
| Molecular Formula | C24H33N7O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 1-ethyl-4-[[2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]-N-propylpyrazole-3-carboxamide |
| SMILES | CCCNC(=O)c1nn(CC)cc1NC(=O)CC12CC3CC(C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2 |
| InChI | InChI=1S/C24H33N7O4/c1-3-5-25-22(33)21-19(14-29(4-2)28-21)27-20(32)11-23-7-16-6-17(8-23)10-24(9-16,15-23)30-13-18(12-26-30)31(34)35/h12-14,16-17H,3-11,15H2,1-2H3,(H,25,33)(H,27,32) |
| InChIKey | WAAPKEYIZZKEAP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|