C25H27ClN6O3 — CID 19338267
N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide (PubChem CID 19338267) has the molecular formula C25H27ClN6O3 and a molecular weight of 494.98 g/mol. Its IUPAC name is N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide.
| Compound Name | N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide |
|---|---|
| PubChem CID | 19338267 |
| Molecular Formula | C25H27ClN6O3 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide |
| SMILES | O=C(CC12CC3CC(C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2)Nc1cnn(Cc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C25H27ClN6O3/c26-20-3-1-2-17(5-20)13-30-14-21(11-27-30)29-23(33)10-24-6-18-4-19(7-24)9-25(8-18,16-24)31-15-22(12-28-31)32(34)35/h1-3,5,11-12,14-15,18-19H,4,6-10,13,16H2,(H,29,33) |
| InChIKey | LTKQUSVAJUFYLH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|